4b8dec5e7199ad302c52bf9eb6914a170491334c,acoular/fbeamform.py,PointSpreadFunction,_get_psf,#PointSpreadFunction#,801

Before Change

                // get indices which have the value True = not yet calculated
                g_ind_calc = self.grid_indices[calc_ind]
            r0 = self.r0
            rm = self.rm
            kj = array(2j*pi*self.freq/self.c)[newaxis]
            steerVecFormulation = steerVecTranslation(self.steer)
            if self.calcmode == "single":
                for ind in g_ind_calc:
                    ac[:,ind] = calcPointSpreadFunction(steerVecFormulation, (r0, rm, kj, [ind]), self.precision)[0,:,0]
                    gp[ind] = True
            elif self.calcmode == "full":
                gp[:] = True
                ac[:] = calcPointSpreadFunction(steerVecFormulation, (r0, rm, kj, arange(r0.shape[0])), self.precision)[0,:,:]
            else: // "block"
                hh = calcPointSpreadFunction(steerVecFormulation, (r0, rm, kj, g_ind_calc), self.precision)
                indh = 0

After Change

        precisionTuple = _precision(self.precision)
        
        // check wether self.freq is part of SteeringVector.f
        freqInSteerObjFreq = isclose(array(self.steer_obj.f), self.freq)
        if freqInSteerObjFreq.any():
            freqInd = flatnonzero(freqInSteerObjFreq)
        else:
            warn("PointSpreadFunction.freq was appended to PointSpreadFunction.steer_obj.f, "\
                 "as it was not an element of the original list! "\
                 "You should check possible implications on beamformer results, etc.", Warning, stacklevel = 2)
            self.steer_obj.f.append(self.freq)
            freqInd = int(-1)
        
        // get the cached data, or, if non-existing, create new structure
        if not fr in self.h5f.root:
            if self.calcmode == "readonly":
                raise ValueError("Cannot calculate missing PSF (freq %s) in \"readonly\" mode." % fr)
            

Instances